| Identification | |
| Name: | Triethylamine |
| Synonyms: | TETN; Triethylamine, Free Base (1.08217); TRI ETHYLAMINE HCL; Triethyl Amine; |
| CAS: | 121-44-8 |
| EINECS: | 204-469-4 |
| Molecular Formula: | C6H15N |
| Molecular Weight: | 101.19 |
| InChI: | InChI=1/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1296 |
| Density: | 0.728 |
| Stability: | Stable. Extremely flammable. Readily forms explosive mixtures with air. Note low flash point. Incompatible with strong oxidizing agents, strong acids, ketones, aldehydes, halogenated hydrocarbons. |
| Refractive index: | 1.399-1.401 |
| Solubility: | 5.5 g./100 g |
| Appearance: | colorless liquid |
| Packinggroup: | II |
| HS Code: | 29211910 |
| Color: | Colorless liquid |
| Usage: | Chemical intermediate, anti-livering agent for urea & melamine based enamels, recovery of gelled paintermediate vehicles, catalyst for polyurethane foams, flux for copper soldering. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
