| Identification | |
| Name: | Triethylamine hydrochloride |
| Synonyms: | Triethylammonium chloride;Triethylamine monohydrochloride;N,N-diethylethanamine hydrochloride;Ethanamine, N,N-diethyl-, hydrochloride;Amine, triethyl, hydrochloride;Triethylamine hydrochloribe; |
| CAS: | 554-68-7 |
| EINECS: | 209-067-2 |
| Molecular Formula: | C6H16ClN |
| Molecular Weight: | 137.65 |
| InChI: | InChI=1/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | 90.5°Cat760mmHg |
| Density: | 0.75g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4136 (20 C) |
| Solubility: | 1440 g/L (20 oC) |
| Appearance: | hexagonal crystals from alcohol. |
| Packinggroup: | II |
| HS Code: | 29211910 |
| Flash Point: | °C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Color: | Colorless liquid |
| Usage: | In prepn of quaternary ammonium compound. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
