| Identification |
| Name: | 4'-Methylacetophenone |
| Synonyms: | 4-Acetyltoluene; 4-Methylacetophenone; 4-Methylacetophenone (p-); 1-Acetyl-4-methylbenzene; 1-Methyl-4-acetylbenzen; methyl p-tolyl ketone; 4-Methyl Acetophenone; Photoinitiator-4MAP |
| CAS: | 122-00-9 |
| EINECS: | 204-514-8 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-7-3-5-9(6-4-7)8(2)10/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1325 |
| Density: | 1.005 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.532-1.535 |
| Solubility: | 0.37 g/L (15 oC) |
| Appearance: | Clear light yellow to yellow liquid |
| HS Code: | 29143900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
