| Identification | |
| Name: | 2'-Methylacetophenone |
| Synonyms: | Acetophenone,2'-methyl- (8CI);Acetophenone, o-methyl- (4CI);1-(2-Methylphenyl)ethanone;1-(2-Tolyl)ethanone;1-(o-Tolyl)ethanone;2-Acetyltoluene;2-Methylphenylmethyl ketone;Methyl 2-methylphenyl ketone;Methylo-tolyl ketone;NSC 84233;o-Acetyltoluene;o-Methylacetophenone;2-methylacetophenone; |
| CAS: | 577-16-2 |
| EINECS: | 209-408-5 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.1751 |
| InChI: | InChI=1S/C9H10O/c1-7-5-3-4-6-9(7)8(2)10/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.026 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.529-1.533 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | clear colourless to light yellow liquid |
| Specification: |
2'-Methylacetophenone , its CAS NO. is 577-16-2, the synonyms are 2-Acetyltoluene ; 2-Methylacetophenone ; o-Acetyltoluene ; o-Methylacetophenone ; 2-Methylacetophenone ; Acetophenone, 2'-methyl- (8CI) ; Ethanone, 1-(2-methylphenyl)- (9CI) . |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
