| Identification | |
| Name: | 4-Chlorobenzoyl chloride |
| Synonyms: | PCOC; p-Chlorobenzolychloride; 4-Chlorobenzolychloride; p-chlorlbenzoyl chloride; p-chlorobenzoyl chloride |
| CAS: | 122-01-0 |
| EINECS: | 204-515-3 |
| Molecular Formula: | C7H4Cl2O |
| Molecular Weight: | 175.01 |
| InChI: | InChI=1/C7H4Cl2O/c8-6-3-1-5(2-4-6)7(9)10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Density: | 1.377 |
| Stability: | Stable. Moisture sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.577-1.579 |
| Solubility: | Insoluble |
| Appearance: | clear, colorless liquid |
| Specification: |
?Benzoylchloride, 4-chloro- , its CAS NO. is 122-01-0, the synonyms are 4-chloro-benzoylchlorid ; Benzoyl chloride, 4-chloro- ; Benzoyl chloride, p-chloro- ; Benzoylchloride,4-chloro- ; para-Chlorobenzoyl chloride? . |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Corrosives area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
