| Identification | |
| Name: | 3-Chlorobenzoyl chloride |
| Synonyms: | m-Chlorobenzoyl chloride |
| CAS: | 618-46-2 |
| EINECS: | 210-552-6 |
| Molecular Formula: | C7H4Cl2O |
| Molecular Weight: | 175.01206 |
| InChI: | InChI=1S/C7H4Cl2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 250kgs |
| Melting Point: | 44 |
| Density: | 1.36 |
| Stability: | No data. |
| Refractive index: | 1.568-1.57 |
| Water Solubility: | Decomposes |
| Solubility: | Decomposes |
| Appearance: | Clear liquid |
| Specification: | clear colourless liquid Safety Statements:26-36/37/39-45-28A 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
