| Identification | |
| Name: | 4-Hydroxybenzaldehyde |
| Synonyms: | p-Hydroxybenzaldehyde, Pract.; p-Hydroxybenzaldehyde |
| CAS: | 123-08-0 |
| EINECS: | 204-599-1 |
| Molecular Formula: | C7H6O2 |
| Molecular Weight: | 122.12 |
| InChI: | InChI=1/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.129 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.57055 (130 C) |
| Appearance: | yellow to light brown crystalline powder |
| Specification: |
?p-Hydroxybenzaldehyde (CAS NO.123-08-0) is also named as 4-Formylphenol ; 4-Hydroxybenzaldehyde ; AI3-15366 ; BRN 0471352 ; CCRIS 8911 ; NSC 2127 ; Parahydroxybenzaldehyde ; UNII-O1738X3Y38 ; USAF M-6 ; p-Formylphenol ; p-Oxybenzaldehyde .?p-Hydroxybenzaldehyde (CAS NO.123-08-0) is yellow to light brown crystalline powder?with aromatic odor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29124900 |
| Sensitive: | Air Sensitive |
| Color: | light yellow to light brown |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
