| Identification | |
| Name: | Azelaic acid |
| Synonyms: | 1, 9-Nonanedioic acid;Nonanedioic acid;Azelaic acid, technical grade;Lepargylic acid;Heptanedicarboxylic acid;Nonanedioic acid Azelaic acid;Empol 1144;1,7-Heptanedicarboxylic acid;Emerox 1144;Emerox 1110;Ammonium Hydrogen Azelate;Azelaic Acid 99%; |
| CAS: | 123-99-9 |
| EINECS: | 204-669-1 |
| Molecular Formula: | C9H16O4 |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C9H16O4/c10-8(11)6-4-2-1-3-5-7-9(12)13/h1-7H2,(H,10,11)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 23720 |
| Stability: | Stable. Combustible. Incompatible with bases, strong oxidizing agents. Readily biodegrades in soil and water with >70% DOC reduction after 28 days. |
| Refractive index: | 1.42808 (107.3 C) |
| Solubility: | 2.4 g/L |
| Appearance: | white flake |
| Specification: |
?Azelaic acid (CAS NO.123-99-9) is also called as?Azelaic acid [USAN:INN]?; 1,7-Heptanedicarboxylic acid ; 1,9-Nonanedioic acid ;?Acide azelaique ; Acide azelaique [French]?;?Acidum azelaicum ;?Azelaic acid, technical grade ;?Heptanedicarboxylic acid?;?Nonanedioic acid . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 29171390 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Monoclinic prismatic needles Yellowish to white crystalline powder Leaflets or needles |
| Usage: | Effective against a number of skin conditions, such as mild to moderate acne, when applied topically in a cream. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
