| Identification |
| Name: | azelaic acid, compound with piperazine-1,4-diethanol |
| Synonyms: | Azelaic acid, compound with piperazine-1,4-diethanol;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol; nonanedioic acid |
| CAS: | 94086-68-7 |
| EINECS: | 301-857-6 |
| Molecular Formula: | C17H34N2O6 |
| Molecular Weight: | 362.4617 |
| InChI: | InChI=1/C9H16O4.C8H18N2O2/c10-8(11)6-4-2-1-3-5-7-9(12)13;11-7-5-9-1-2-10(4-3-9)6-8-12/h1-7H2,(H,10,11)(H,12,13);11-12H,1-8H2 |
| Molecular Structure: |
![(C17H34N2O6) Azelaic acid, compound with piperazine-1,4-diethanol;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol; no...](https://img.guidechem.com/pic/image/94086-68-7.gif) |
| Properties |
| Flash Point: | 318.4°C |
| Boiling Point: | 602.9°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 318.4°C |
| Safety Data |
| |
 |
