| Identification |
| Name: | 1-Naphthalenol,2-butyl-4-methoxy-5-methyl-, 1-acetate |
| Synonyms: | 1-Naphthalenol,2-butyl-4-methoxy-5-methyl-, acetate (9CI) |
| CAS: | 123332-32-1 |
| Molecular Formula: | C18H22 O3 |
| Molecular Weight: | 286.3655 |
| InChI: | InChI=1/C18H22O3/c1-5-6-9-14-11-16(20-4)17-12(2)8-7-10-15(17)18(14)21-13(3)19/h7-8,10-11H,5-6,9H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 182.7°C |
| Boiling Point: | 428.6°Cat760mmHg |
| Density: | 1.071g/cm3 |
| Refractive index: | 1.554 |
| Flash Point: | 182.7°C |
| Safety Data |
| |
 |