| Identification |
| Name: | 1-Naphthalenol,2,3-diethyl-4-methoxy-5-methyl-, 1-acetate |
| Synonyms: | 1-Naphthalenol,2,3-diethyl-4-methoxy-5-methyl-, acetate (9CI) |
| CAS: | 123332-38-7 |
| Molecular Formula: | C18H22 O3 |
| Molecular Weight: | 286.3655 |
| InChI: | InChI=1/C18H22O3/c1-6-13-14(7-2)18(20-5)16-11(3)9-8-10-15(16)17(13)21-12(4)19/h8-10H,6-7H2,1-5H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 167.2°C |
| Boiling Point: | 395.9°Cat760mmHg |
| Density: | 1.072g/cm3 |
| Refractive index: | 1.557 |
| Flash Point: | 167.2°C |
| Safety Data |
| |
 |