| Identification | |
| Name: | N-Chlorosuccinimide |
| Synonyms: | 2,5-Pyrrolidinedione, 1-chloro-; Chlorosuccinimide; NCS; Pyrrolidinedione, 1-chloro-; Succinchlorimide; |
| CAS: | 128-09-6 |
| EINECS: | 204-878-8 |
| Molecular Formula: | C4H4ClNO2 |
| Molecular Weight: | 133.53 |
| InChI: | InChI=1/C4H4ClNO2/c5-6-3(7)1-2-4(6)8/h1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Density: | 1.5 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.532 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white crystalline powder |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| HS Code: | 29251995 |
| Storage Temperature: | Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Color: | Orthorhombic crystals PLATES FROM CARBON TETRACHLORIDE White crystalline powder |
| Usage: | Chlorinating agent. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
