| Identification | |
| Name: | D-Aspartic acid,N-acetyl- |
| Synonyms: | N-Acetyl-D-asparticacid; |
| CAS: | 128574-89-0 |
| Molecular Formula: | C6H9NO5 |
| Molecular Weight: | 175.13936 |
| InChI: | InChI=1/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/t4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.422 g/cm3 |
| Refractive index: | 1.505 |
| Specification: |
The N-Acetyl-D-aspartic acid with the CAS number 128574-89-0 is also called D-Aspartic acid,N-acetyl-. Its molecular formula is C6H9NO5. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: -1.06; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 6; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 72.91 Å2; (7)Index of Refraction: 1.505; (8)Molar Refractivity: 36.55 cm3; (9)Molar Volume: 123.1 cm3; (10)Polarizability: 14.49×10-24cm3; (11)Surface Tension: 61.5 dyne/cm; (12)Enthalpy of Vaporization: 74.57 kJ/mol; (13)Vapour Pressure: 2×10-8 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
