| Identification |
| Name: | D-Aspartic acid,N-methyl- |
| Synonyms: | Asparticacid, N-methyl-, D- (8CI);N-Methyl-D-aspartic acid;NMDA; |
| CAS: | 6384-92-5 |
| EINECS: | 227-012-0 |
| Molecular Formula: | C5H9NO4 |
| Molecular Weight: | 147.13 |
| InChI: | InChI=1/C5H9NO4/c1-6-3(5(9)10)2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)/t3-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.343 g/cm3 |
| Stability: | No data. |
| Refractive index: | -15 ° (C=2, H2O) |
| Alpha: | -28 º (C=1, HCL 6N) |
| Water Solubility: | slightly soluble |
| Solubility: | Slightly soluble in water |
| Appearance: | White Solid |
| Biological Activity: | Prototypic NMDA receptor agonist. Also available as part of the Mixed NMDA Receptor Tocriset™ . |
| Storage Temperature: | Store at RT. |
| Color: | white |
| Usage: | An amino acid that, as the d-isomer, is the defining agonist for the nmda receptor subtype of glutamate receptors. |
| Safety Data |
| |
 |
