Identification |
Name: | Di-p-Chlorobenzyl N,N-Diisopropylphosphoramidite |
Synonyms: | bis(4-chlorobenzyl) bis(1-methylethyl)amidophosphite |
CAS: | 128858-43-5 |
Molecular Formula: | C20H26Cl2NO2P |
Molecular Weight: | 0 |
InChI: | InChI=1/C20H26Cl2NO2P/c1-15(2)23(16(3)4)26(24-13-17-5-9-19(21)10-6-17)25-14-18-7-11-20(22)12-8-18/h5-12,15-16H,13-14H2,1-4H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 212.6°C |
Boiling Point: | 427.9°C at 760 mmHg |
Flash Point: | 212.6°C |
Usage: | A versatile phosphitylating agent for the phosphorylation of hydroxy amino acids and the preparation of protected phosphopeptides |
Safety Data |
|
|