| Identification | |
| Name: | Dimethyl N,N-Diisopropylphosphoramidite |
| Synonyms: | - |
| CAS: | 29952-64-5 |
| Molecular Formula: | C8H20NO2P |
| Molecular Weight: | 193.22 |
| InChI: | InChI=1/C8H20NO2P/c1-7(2)9(8(3)4)12(10-5)11-6/h7-8H,1-6H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 42°C |
| Boiling Point: | 54 °C10 mm Hg(lit.) |
| Density: | 0.840 g/mL at 20 °C(lit.) |
| Refractive index: | n20/D 1.420(lit.) |
| Flash Point: | 42°C |
| Storage Temperature: | 2-8°C |
| Usage: | A useful reagent for the efficient phosphorylation of alcohols |
| Safety Data | |
 |
|
