| Identification |
| Name: | Dapoxetine hydrochloride |
| Synonyms: | Benzenemethanamine,N,N-dimethyl-a-[2-(1-naphthalenyloxy)ethyl]-,hydrochloride, (S)-;LY 210448 hydrochloride; |
| CAS: | 129938-20-1 |
| Molecular Formula: | C21H24ClNO |
| Molecular Weight: | 341.88 |
| InChI: | InChI=1/C21H23NO.ClH/c1-22(2)20(18-10-4-3-5-11-18)15-16-23-21-14-8-12-17-9-6-7-13-19(17)21;/h3-14,20H,15-16H2,1-2H3;1H/t20-;/m0./s1 |
| Molecular Structure: |
![(C21H24ClNO) Benzenemethanamine,N,N-dimethyl-a-[2-(1-naphthalenyloxy)ethyl]-,hydrochloride, (S)-;LY 210448 hydroc...](https://img.guidechem.com/casimg/129938-20-1.gif) |
| Properties |
| Melting Point: | 175-1790C |
| Appearance: | White to off-white crystalline solid |
| Specification: |
?Dapoxetine hydrochloride , its cas register number is 129938-20-1. It also can be called ( )-Dapoxetine hydrochloride ; LY 210448 hydrochloride ; Dapoxetine HCl ; and (1S)-N,N-Dimethyl-3-naphthalen-1-yloxy-1-phenyl-propan-1-amine hydrochloride .
|
| Usage: | Selective serotonin reuptake inhibitor (SSRI) |
| Safety Data |
| |
 |