| Identification | |
| Name: | Dimethyl phthalate |
| Synonyms: | Mipax;Avolin;Fermine;Dimethyl benzene-o-dicarboxylate;DMP;Unimoll DM;Dimethyl Phthalate (P001);o-dimethyl phthalate;Di methyl phthalate;Phthalsaeuredimethylester;1,2-benzenedicarboxylic acid, dimethyl ester;Solvanom;Repeat motifs (protein)Repeftal;Phthalic acid methyl ester;Solvarone;dimethyl benzene-1,2-dicarboxylate; |
| CAS: | 131-11-3 |
| EINECS: | 205-011-6 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.19 |
| InChI: | InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Density: | 1.192 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids, strong bases, nitrates. Sensitive to prolonged exposure to light. |
| Refractive index: | 1.514-1.516 |
| Water Solubility: | soluble in benzene or acetone |
| Solubility: | soluble in benzene or acetone |
| Appearance: | clear oily liquid |
| Packinggroup: | Z01 |
| Color: | Pale yellow Colorless, oily liquid [Note: A solid below 42 degrees F] |
| Safety Data | |
 |
|
