| Identification |
| Name: | Diethyl phthalate |
| Synonyms: | Diethylester kyseliny ftalove [Czech];Diethyl 1,2-benzenedicarboxylate;o-Benzenedicarboxylic acid diethyl ester;Estol 1550;Anozol;Unimoll DA;Phthalsaeurediaethylester;Neantine;DEP;1,2-Benzenedicarboxylic acid,esters,diethyl ester;4-09-00-03172 (Beilstein Handbook Reference);Phthalic acid, diethyl ester;RCRA waste no. U088;Diethyl Phthalate [USAN];NCI-C60048;Phthalol;DPX-F5384;Palatinol A;Placidol E;o-Benzenedicarboxylic acid, diethyl ester;Diethyl o-phenylenediacetate;Solvanol;1,2-Benzenedicarboxylic acid, diethyl ester;Diethyl o-phthalate;diethyl benzene-1,2-dicarboxylate;Diethyl Phthalate 99%min; |
| CAS: | 84-66-2 |
| EINECS: | 201-550-6 |
| Molecular Formula: | C12H14O4 |
| Molecular Weight: | 222.24 |
| InChI: | InChI=1/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |
![(C12H14O4) Diethylester kyseliny ftalove [Czech];Diethyl 1,2-benzenedicarboxylate;o-Benzenedicarboxylic acid di...](https://img.guidechem.com/casimg/84-66-2.gif) |
| Properties |
| Melting Point: | -3 C |
| Density: | 1.118 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids, alkalies. |
| Refractive index: | 1.501-1.503 |
| Solubility: | Insoluble Appearance:clear oily liquid Transport Information:200kgs Hazard Symbols:9 (Packing Group: III) UN NO. |
| Appearance: | Water-white to colorless, odorless, oily liquid. |
| Packinggroup: | Z01 |
| HS Code: | 29173400 |
| Storage Temperature: | Keep away from heat and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless oily liquid Colorless to water-white, oily liquid. |
| Usage: | In manufacture celluloid, solvent for cellulose acetate in manufacture varnishes & dopes, fixative for perfumes, denaturing alcohol. |
| Safety Data |
| |
 |