| Identification | |
| Name: | 2,2',4,4'-Tetrahydroxybenzophenone |
| Synonyms: | Benzophenone, 2,2,4,4-tetrahydroxy-;2,2',4,4'-Tetrahydroxybenzophenone (UV-2);Eusorb UV-246;di(2,4-dihydroxyphenyl)methanone;BP-2;Sumisorb 150;Uvinul D-50;Methanone, bis (2,4-dihydroxyphenyl)-;2,2',4,4'-Tetrahydroxy benzophenone (Benzophenone 2);bis(2,4-dihydroxyphenyl)methanone;Methanone,bis(2,4-dihydroxyphenyl)-;Seesorb 106;2,2',4,4'-Tetrahydroxy Benzophenone;2,2',4,4'-Tetrahydroxybenzophenone (BP-2);2,2'4,4'Tetrahydroxy Benzophenone (UV Absorber D50); |
| CAS: | 131-55-5 |
| EINECS: | 205-028-9 |
| Molecular Formula: | C13H10O5 |
| Molecular Weight: | 246.22 |
| InChI: | InChI=1/C13H10O5/c14-7-1-3-9(11(16)5-7)13(18)10-4-2-8(15)6-12(10)17/h1-6,14-17H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.526 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.718 |
| Solubility: | Insoluble |
| Appearance: | yellow to brown crystalline powder |
| Specification: |
?Benzophenone-2 , its cas register number is 131-55-5. It also can be called?2,2',4,4'-Tetrahydroxybenzophenone?; Di(2,4-dihydroxyphenyl)methanone ; Bis(2,4-dihydroxyphenyl)methanone ;?Benzophenone, 2,2',4,4'-tetrahydroxy- ; Methanone, bis(2,4-dihydroxyphenyl)- .It is a?yellow to brown crystalline powder. |
| Packinggroup: | II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
