| Identification | |
| Name: | 2-Propenoic acid,3-(4-methoxyphenyl)-, 2-ethoxyethyl ester |
| Synonyms: | Cinnamicacid, p-methoxy-, 2-ethoxyethyl ester (6CI,7CI,8CI); Ethanol, 2-ethoxy-,p-methoxycinnamate (8CI); 2-Ethoxyethyl 4-methoxycinnamate; 2-Ethoxyethylp-methoxycinnamate; Cinoxate; Giv Tan F; Give-Tan; Phiasol; Sundare;p-Methoxycinnamic acid 2-ethoxyethyl ester |
| CAS: | 1322-65-2 |
| Molecular Formula: | C14H18O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C14H18O4/c1-3-17-10-11-18-14(15)9-6-12-4-7-13(16-2)8-5-12/h4-9H,3,10-11H2,1-2H3/b9-6+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | Solidifies below -25 deg C |
| Solubility: | Soluble in glycerol 0.5%, propolyene glycol 5%. Miscible with alcohols and vegetable oils. Practically insoluble in water 0.05%. |
| Color: | Viscous liquid, may have slight yellow tinge |
| Safety Data | |
 |
|
