| Identification | |
| Name: | 2-Propenoic acid,2-ethoxyethyl ester |
| Synonyms: | Acrylicacid, 2-ethoxyethyl ester (6CI,7CI,8CI); Ethanol, 2-ethoxy-, acrylate (8CI);2-Ethoxyethyl acrylate; A-EE; Cellosolve acrylate; EM 211; Ethylene glycolmonoethyl ether acrylate; Ethylene glycol monoethyl ether propenoate; NSC72733; NSC 8390 |
| CAS: | 106-74-1 |
| EINECS: | 203-429-3 |
| Molecular Formula: | C7H12 O3 |
| Molecular Weight: | 144.19 |
| InChI: | InChI=1/C7H12O3/c1-3-7(8)10-6-5-9-4-2/h3H,1,4-6H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Flash Point: | 52.8°C |
| Boiling Point: | 171°Cat760mmHg |
| Density: | 0.878g/cm3 |
| Refractive index: | 1.427 |
| Specification: | Safety Statements:26-36/37/39-61-28 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 61:Avoid release to the environment. Refer to special instructions safety data sheet 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) |
| Flash Point: | 52.8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
 |
|
