| Identification |
| Name: | Carbonochloridic acid,cyclohexyl ester |
| Synonyms: | Formicacid, chloro-, cyclohexyl ester (6CI,7CI,8CI);(Cyclohexyloxy)carbonylchloride;Chloroformic acid cyclohexyl ester; |
| CAS: | 13248-54-9 |
| EINECS: | 236-230-5 |
| Molecular Formula: | C7H11ClO2 |
| Molecular Weight: | 162.61404 |
| InChI: | InChI=1S/C7H11ClO2/c8-7(9)10-6-4-2-1-3-5-6/h6H,1-5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Density: | 1.14 g/cm3 |
| Refractive index: | 1.464 |
| Water Solubility: | practically insoluable (Decomposes- Hydrolysis may occur in the presence of water |
| Solubility: | practically insoluable (Decomposes- Hydrolysis may occur in the presence of water |
| Appearance: | clear liquid |
| Safety Data |
| Hazard Symbols |
3 (Packing group: II)
|
| |
 |
