| Identification | |
| Name: | tetracaine hydrochloride usp |
| Synonyms: | Tetracaine HCl; 2-dimethylaminoethyl 4-n-butylaminobenzoate hydrochloride; 4-(Butylamino)benzoic acid 2-(dimethylamino)ethyl ester hydrochloride; 4-(butylamino)-Benzoic acid, 2-(dimethylamino)ethyl ester, monohydrochloride; p-butylaminobenzoyl-2-dimethylaminoethanol hydrochloride; Amethocaine hydrochloride; Anethaine; Butethanol; Curtacain; Decicain; Gingicain M; Menonasal; Pantocaine; Pontocaine hydrochloride; Tetracaine hydrochloride; Tonexol; Tetracaine?HCL |
| CAS: | 136-47-0 |
| EINECS: | 205-248-5 |
| Molecular Formula: | C15H24N2O2?HCl |
| Molecular Weight: | 264.36326 |
| InChI: | InChI=1S/C15H24N2O2/c1-4-5-10-16-14-8-6-13(7-9-14)15(18)19-12-11-17(2)3/h6-9,16H,4-5,10-12H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Melting Point: | 149oC |
| Flash Point: | 189.3 oC |
| Boiling Point: | 389.4 oC at 760 mmHg |
| Density: | g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Water Solubility: | freely soluble in water, soluble in alcohol and practically insoluble in ether. |
| Solubility: | freely soluble in water, soluble in alcohol and practically insoluble in ether. |
| Appearance: | White or off white crystalline powder |
| Specification: |
Incompatibilities |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Flash Point: | 189.3 oC |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Topical opththalmic anesthetic; used for spinal anesthesia. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
