| Identification |
| Name: | L-Ornithine,N5-[imino(propylamino)methyl]- |
| Synonyms: | (S)-2-Amino-5-(N'-propyl-guanidino)-pentanoic acid; |
| CAS: | 137361-05-8 |
| Molecular Formula: | C9H20N4O2 |
| Molecular Weight: | 216.28 |
| InChI: | InChI=1/C9H20N4O2/c1-2-5-12-9(11)13-6-3-4-7(10)8(14)15/h7H,2-6,10H2,1H3,(H,14,15)(H3,11,12,13)/t7-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 202.4 °C |
| Boiling Point: | 411 °C at 760 mmHg |
| Density: | 1.24 g/cm3 |
| Refractive index: | 1.549 |
| Biological Activity: | Highly selective and potent inhibitor of nNOS (K i = 57 nM). Displays 3158-fold and 149-fold selectivity over iNOS and eNOS respectively. Hypotensive in vivo . |
| Flash Point: | 202.4 °C |
| Usage: | A highly selective competitive inhibitor and inactivator of all three isoforms of NOS. |
| Safety Data |
| |
 |
