| Identification | |
| Name: | L-Ornithine,N5-[imino(nitroamino)methyl]- |
| Synonyms: | Ornithine,N5-(nitroamidino)-, L- (8CI);(+)-NG-Nitroarginine;L-Arginine, NG-nitro-;L-Arginine, w-nitro-;L-NNA;L-NOARG;NG-Nitro-L-arginine;NOLA;NSC 53662;Nitro-L-arginine;Nw-Nitro-L-arginine;w-Nitro-L-arginine; |
| CAS: | 2149-70-4 |
| EINECS: | 218-418-9 |
| Molecular Formula: | C6H13N5O4 |
| Molecular Weight: | 219.19852 |
| InChI: | InChI=1S/C6H13N5O4/c7-4(5(12)13)2-1-3-9-6(8)10-11(14)15/h4H,1-3,7H2,(H,12,13)(H3,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 236.428°C |
| Boiling Point: | 467.322°C at 760 mmHg |
| Density: | 1.659g/cm3 |
| Refractive index: | 1.638 |
| Alpha: | 23.5 º (C=4, 2N HCL 24 ºC) |
| Water Solubility: | Soluble in 0.1N HCl. Moderately soluble in water; insoluble in methanol. |
| Solubility: | Soluble in 0.1N HCl. Moderately soluble in water; insoluble in methanol. |
| Appearance: | White to off-white solid. |
| Specification: | WHITE TO OFF-WHITE POWDER Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Biological Activity: | NO synthase inhibitor. |
| Flash Point: | 236.428°C |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols | |
 |
|
