| Identification | |
| Name: | 7-Methoxy-1-naphthylacetonitrile |
| Synonyms: | 1-Cyanomethyl-7-methoxynaphthalene; 2-(7-Methoxy-1-naphthyl)acetonitrile; 7-Methoxy-1-naphthaleneacetinitrile |
| CAS: | 138113-08-3 |
| Molecular Formula: | C13H11NO |
| Molecular Weight: | 197.23 |
| InChI: | InChI=1/C13H11NO/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12/h2-6,9H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.135g/cm3 |
| Refractive index: | 1.609 |
| Appearance: | tan solid |
| Specification: |
The 7-Methoxy-1-naphthylacetonitrile with cas register number of 138113-08-3 belongs to the categories of Aromatics Compounds. It has the appearance of tan solid. Its systematic name is called (7-methoxynaphthalen-1-yl)acetonitrile. The physical properties about this chemical are: (1)ACD/LogP: 2.60; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.6; (4)ACD/LogD (pH 7.4): 2.6; (5)ACD/BCF (pH 5.5): 55.24; (6)ACD/BCF (pH 7.4): 55.24; (7)ACD/KOC (pH 5.5): 614.76; (8)ACD/KOC (pH 7.4): 614.76; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.609; (13)Molar Refractivity: 60.23 cm3; (14)Molar Volume: 173.7 cm3; (15)Surface Tension: 46 dyne/cm; (16)Density: 1.135 g/cm3; (17)Flash Point: 157.7 °C; (18)Enthalpy of Vaporization: 62.17 kJ/mol; (19)Boiling Point: 374.3 °C at 760 mmHg; (20)Vapour Pressure: 8.4E-06 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
