| Identification |
| Name: | 2-Naphthylacetonitrile |
| Synonyms: | 2-Naphthaleneacetonitrile; 2-Naphthtyl acetonitrile |
| CAS: | 7498-57-9 |
| EINECS: | 231-352-5 |
| Molecular Formula: | C12H9N |
| Molecular Weight: | 167.21 |
| InChI: | InChI=1/C12H9N/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9H,7H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3276 |
| Flash Point: | 303ºCat 760 mmHg |
| Density: | 1.092 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.634 |
| Solubility: | Insoluble |
| Appearance: | White to pale yellow powder. |
| Packinggroup: | III |
| Flash Point: | 303ºCat 760 mmHg |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
