| Identification |
| Name: | Benzenemethanamine,4-fluoro- |
| Synonyms: | Benzylamine,p-fluoro- (7CI,8CI);(4-Fluorophenyl)methanamine;1-(4-Fluorophenyl)methanamine;4-Fluorobenzenemethanamine;NSC 158269;[(4-Fluorophenyl)methyl]amine;p-Fluorobenzylamine; |
| CAS: | 140-75-0 |
| EINECS: | 205-430-4 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 8/PG 2 |
| Density: | 1.09 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5117 |
| Solubility: | Very soluble |
| Appearance: | Clear, colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive |
| Usage: | A benzylamine derivative as a potassium channel blocking agent. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
