| Identification | |
| Name: | 2-Bromo-4-fluorotoluene |
| Synonyms: | 2-bromo-4-fluoro-1-methyl-benzene;2-Bromo-4-fluoro toluene; |
| CAS: | 1422-53-3 |
| EINECS: | 215-830-0 |
| Molecular Formula: | C7H6BrF |
| Molecular Weight: | 189.03 |
| InChI: | InChI=1/C7H6BrF/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.526 |
| Stability: | Has not been fully evaluated. |
| Refractive index: | 1.527-1.529 |
| Appearance: | Colorless or Yellowish liquid |
| Specification: |
??2-Bromo-4-fluorotoluene?,?its cas register number is 1422-53-3. It also can be called?2-bromo-4-fluoro-1-methyl- ; 2-Bromo-4-fluorotoluene 99% ; 2-Bromo-4-fluorotoluene99% .?2-Bromo-4-fluorotoluene (CAS NO.1422-53-3) is a?colorless to light yellow liquid. |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
