| Identification |
| Name: | 3-Bromo-4-fluorotoluene |
| Synonyms: | 2-bromo-1-fluoro-4-methyl-benzene; |
| CAS: | 452-62-0 |
| EINECS: | 207-201-4 |
| Molecular Formula: | C7H6BrF |
| Molecular Weight: | 189.03 |
| InChI: | InChI=1/C7H6BrF/c1-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 164? |
| Density: | 1.507 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.531 |
| Appearance: | colorless to light yellow liquid |
| Flash Point: | 164? |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
