| Identification | |
| Name: | Phosphonic acid, zincsalt (1:1) |
| Synonyms: | Zinc phosphite(7CI); Expert NP 1500; Expert NP 1530; Protex YM 92NS; Secondary zincphosphite; YM 60; Zinc phosphite (ZnHPO3) |
| CAS: | 14332-59-3 |
| EINECS: | 238-279-8 |
| Molecular Formula: | H3O3 P . Zn |
| Molecular Weight: | 147.37 |
| InChI: | InChI=1/H3O3P.Zn/c1-4(2)3;/h4H,(H2,1,2,3);/q;+2/p-2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Zinc phosphite ,its CAS NO. is 14332-59-3,the synonyms is EINECS 238-279-8 ; Nera ; Nera emulze ; Secondary zinc phosphite ; Phosphonic acid, zinc salt (1:1) ; Zinc phosphonate . |
| Report: |
ZINC and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Safety Data | |
 |
|
