| Identification | |
| Name: | Dithionous acid, zincsalt (1:1) |
| Synonyms: | Zincdithionite (6CI,7CI); Zinc dithionite (ZnS2O4); Zinc hydrosulfite |
| CAS: | 7779-86-4 |
| EINECS: | 231-942-2 |
| Molecular Formula: | H2O4 S2 . Zn |
| Molecular Weight: | 193.49 |
| InChI: | InChI=1/H2O4S2.Zn/c1-5(2)6(3)4;/h(H,1,2)(H,3,4);/q;+2/p-2/rO4S2Zn/c1-5-3-7-4-6(5)2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1931 |
| Solubility: | 28.00 lb/100 lb water at 68 deg F |
| Specification: |
Zinc hydrosulfite ,its cas register number is 7779-86-4.It also can be called Dithionous acid,zinc salt (1:1) ; Zinc dithionite .It is noncombustible and is not environmentally friendly,so we should be taken to limit its spread to the environment.Anyway,it is also a strong reducing agent and can react with oxidizing agents to generate heat and products.The reaction may be very violent. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Color: | White amorphous solid |
| Safety Data | |
 |
|
