| Identification | |
| Name: | Sodium bicarbonate |
| Synonyms: | Carbonic acid, monosodium salt;Natriumhydrogenkarbonat;Meylon;Carbonic acid disodium salt;SodaSee;Monosodium hydrogen carbonate;Monosodium carbonate;monosodium salt ;; see the subdivided heading;Component of Col-Evac;Soda Mint;Sodium bicarbonate(1:1);Carbonic acid, disodium salt;Natriumbicarbonat, Natriumhydrogencarbonat;Sodium Bicarbonate food grade; |
| CAS: | 144-55-8 |
| EINECS: | 205-633-8 |
| Molecular Formula: | NaHCO3 |
| Molecular Weight: | 84.01 |
| InChI: | InChI=1/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.159 |
| Stability: | Stable. |
| Refractive index: | 1.500 |
| Solubility: | Soluble in water:9 g/100 mL (20 oC) |
| Appearance: | White powder or superfime crystal |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| HS Code: | 28363000 |
| Biological Activity: | Commonly used laboratory reagent |
| Color: | White, monoclinic prisms White crystalline powder or granules |
| Usage: | In manufacture of many sodium salts, source of carbon dioxide, in effervescent salts, beverages, cleaning compound. |
| Safety Data | |
 |
|
