| Identification | |
| Name: | Methanone,(2-amino-5-bromophenyl)(2-fluorophenyl)- |
| Synonyms: | Benzophenone,2-amino-5-bromo-2'-fluoro- (7CI,8CI);(2-Amino-5-bromophenyl)-(2-fluorophenyl)methanone;2-Amino-5-bromo-2'-fluorobenzophenone; |
| CAS: | 1479-58-9 |
| EINECS: | 216-037-2 |
| Molecular Formula: | C13H9BrFNO |
| Molecular Weight: | 294.1191 |
| InChI: | InChI=1/C13H9BrFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.546 g/cm3 |
| Refractive index: | 1.633 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | yellow crystalline powder |
| Specification: |
2-Amino-2'-fluoro-5-bromobenzophenone (1479-58-9) is stable under normal temperatures and pressures but incompatible with strong oxidizing agents.Hazardous decomposition products are nitrogen oxides, carbon monoxide, carbon dioxide, hydrogen fluoride gas, hydrogen bromide.Hazardous polymerization has not been reported. |
| Usage: | Intermeidate in the preparation of many GABA modulators |
| Safety Data | |
 |
|
