| Identification | |
| Name: | Methanone,(2-amino-5-chlorophenyl)(2-fluorophenyl)- |
| Synonyms: | Benzophenone,2-amino-5-chloro-2'-fluoro- (7CI,8CI); |
| CAS: | 784-38-3 |
| EINECS: | 212-316-8 |
| Molecular Formula: | C13H9ClFNO |
| Molecular Weight: | 249.67 |
| InChI: | InChI=1/C13H9ClFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.342 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | Yellow needle crystal |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A starting material for the synthesis of diazepam and other benzodiazepines |
| Safety Data | |
 |
|
