| Identification | |
| Name: | N-Benzylbenzamide |
| Synonyms: | - |
| CAS: | 1485-70-7 |
| EINECS: | 216-063-4 |
| Molecular Formula: | C14H13NO |
| Molecular Weight: | 211.25912 |
| InChI: | InChI=1S/C14H13NO/c16-14(13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.109 g/cm3 |
| Refractive index: | 1.59 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data ( |
| Solubility: |
|
| Appearance: | white crystalline solid |
| Safety Data | |
 |
|
