Identification |
Name: | 1-Fluoro-2-nitrobenzene |
Synonyms: | Fluoronitrobenzene1; Fluoronitrobenzenecolorlessliq; 2-Fluoronitrobenzene; O-NITROFLUOROBENZENE; O-FLUORONITROBENZENE; 1-fluoro-2-nitro-benzen; Benzene, o-nitrofluoro-; 2-NITROFLUOROBENZENE |
CAS: | 1493-27-2 |
EINECS: | 216-088-0 |
Molecular Formula: | C6H4FNO2 |
Molecular Weight: | 141.1 |
InChI: | InChI=1/C6H4FNO2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H |
Molecular Structure: |
 |
Properties |
Transport: | 2810 |
Density: | 1.335 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5307-1.5327 |
Water Solubility: | immiscible |
Solubility: | immiscible |
Appearance: | Light yellow liquid |
Packinggroup: | III |
HS Code: | 29049085 |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Color: | deep greenish-yellow |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |