| Identification | |
| Name: | 4-Bromo-1-fluoro-2-nitrobenzene |
| Synonyms: | 1-Bromo-3-nitro-4-fluorobenzene;1-Bromo-4-fluoro-3-nitrobenzene;2-Fluoro-5-bromonitrobenzene;Benzene,4-bromo-1-fluoro-2-nitro-;4-Fluoro-3-nitrobromobenzene;5-Bromo-2-fluoronitrobenzene; |
| CAS: | 364-73-8 |
| Molecular Formula: | C6H3BrFNO2 |
| Molecular Weight: | 220 |
| InChI: | InChI=1/C6H3BrFNO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.786 |
| Refractive index: | 1.575-1.578 |
| Appearance: | clear yellow to brownish liquid after melting |
| Specification: |
4-Bromo-1-fluoro-2-nitrobenzene (CAS NO.364-73-8) is also named as Benzene,4-bromo-1-fluoro-2-nitro- ; 1-Bromo-3-nitro-4-fluorobenzene ; 1-Bromo-4-fluoro-3-nitrobenzene ; 2-Fluoro-5-bromonitrobenzene ; 4-Fluoro-3-nitrobromobenzene ; 5-Bromo-2-fluoronitrobenzene . 4-Bromo-1-fluoro-2-nitrobenzene (CAS NO.364-73-8) is clear yellow to brownish liquid after melting. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
