| Identification | |
| Name: | (+)-Methyl phenyl carbinol |
| Synonyms: | (R)-(+)-1-Phenylethanol |
| CAS: | 1517-69-7 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.16 |
| InChI: | InChI=1/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2937 |
| Density: | 1.012 |
| Stability: | Stable. Flammable. Incompatible with strong acids, strong oxidizing agents. |
| Refractive index: | 1.526-1.528 |
| Alpha: | 42.5 º (NEAT) |
| Solubility: | Sol in glycerol, mineral oil, alcohol SOL IN MOST ORGANIC SOLVENTS A high solvency for alcohol-soluble cellulose nitrate, cellulose acetate, and cellulose acetobutyrate; for many natural and synthetic resins; and for fats and oils. In contrast to benzyl alcohol, it is miscible with white spirit. In water, 1,950 mg/l @ 25 deg C |
| Appearance: | Colorless to light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | COLORLESS LIQ |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
