| Identification |
| Name: | 4-Bromophenyl methyl carbinol |
| Synonyms: | 4-Bromo-alpha-methylbenzyl alcohol~4-Bromophenyl methyl carbinol; 1-(4-Bromophenyl)ethanol |
| CAS: | 5391-88-8 |
| EINECS: | 226-389-9 |
| Molecular Formula: | C8H9BrO |
| Molecular Weight: | 201.06 |
| InChI: | InChI=1/C8H9BrO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2810 |
| Density: | 1.46 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5680 |
| Water Solubility: | negligible in water |
| Solubility: | negligible in water |
| Appearance: | white crystalline solid liquid |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
