| Identification | |
| Name: | Cartap |
| Synonyms: | SanukiteSanvex;Carbamothioic acid,S,S'-[2-(dimethylamino)-1,- 3-propanediyl] ester;Thiobel;(3-carbamoylsulfanyl-2-dimethylamino-propyl)sulfanylformamide;Monosultap;Cartap 98%TC; |
| CAS: | 15263-53-3 |
| EINECS: | 239-309-2 |
| Molecular Formula: | C7H15N3O2S2 |
| Molecular Weight: | 237.35 |
| InChI: | InChI=1/C7H15N3O2S2/c1-10(2)5(3-13-6(8)11)4-14-7(9)12/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12) |
| Molecular Structure: | ![(C7H15N3O2S2) SanukiteSanvex;Carbamothioic acid,S,S'-[2-(dimethylamino)-1,- 3-propanediyl] ester;Thiobel;(3-carbam...](https://img1.guidechem.com/chem/e/dict/84/15263-53-3.jpg) |
| Properties | |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.591 |
| Appearance: | colorless slightly hygroscopic and crystalline solid with slight odor |
| Specification: |
?Cartap , its CAS NO. is 15263-53-3, the synonyms are 2-Dimethylamino-1,3-bis(carbamoylthio)propane ; Carbamicacid,thio-,s,s'-(2-(dimethylamino)trimethylene)ester ; Carbamothioicacid,s,s'-(2-(dimethylamino)-1,3-propanediyl)ester;s,s'-(2-(dimethylamino)-1,3-propanediyl)dicarbamothioate ; Sanvex;t-1258 ; thiobel .?? |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
