| Identification | |
| Name: | Cartap hydrochloride |
| Synonyms: | Carbamicacid, thio-, S,S'-[2-(dimethylamino)trimethylene] ester, monohydrochloride(8CI);1,3-Propanedithiol, 2-(dimethylamino)-, dicarbamate(ester), monohydrochloride (8CI);2-(Dimethylamino)-1,3-propanedithiol dicarbamate hydrochloride;Caldan;NTD 2;Padan;Padan 4 G;Suntap;Vegetox; |
| CAS: | 15263-52-2 |
| EINECS: | 239-309-2 |
| Molecular Formula: | C7H15N3O2S2.HCl |
| Molecular Weight: | 273.80384 |
| InChI: | InChI=1S/C7H15N3O2S2.ClH/c1-10(2)5(3-13-6(8)11)4-14-7(9)12;/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12);1H |
| Molecular Structure: | ![(C7H15N3O2S2.HCl) Carbamicacid, thio-, S,S'-[2-(dimethylamino)trimethylene] ester, monohydrochloride(8CI);1,3-Propaned...](https://img1.guidechem.com/chem/e/dict/79/15263-52-2.jpg) |
| Properties | |
| Transport: | 2771 |
| Density: | 1.42 g/cm3 (20 C) |
| Appearance: | COA |
| Specification: |
The chemical synonyms Cartap hydrochloride (CAS NO.15263-52-2) is 1,3-Bis(carbamoylthio)-2-(n,n-dimethylamino)propanemonohydrochloride . |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Storage Temperature: | Keep tightly closed. |
| Usage: | Nereistoxin anelog insectide. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
