| Identification | |
| Name: | 4-Bromoisoquinoline |
| Synonyms: | 4-bromoisoqunoline |
| CAS: | 1532-97-4 |
| EINECS: | 216-244-8 |
| Molecular Formula: | C9H6BrN |
| Molecular Weight: | 208.06 |
| InChI: | InChI=1/C9H6BrN/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | >110 C |
| Density: | 1.564g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.673 |
| Solubility: | Insoluble |
| Appearance: | light yellow crystals |
| Flash Point: | >110 C |
| Usage: | Shows selective inhibition of cAMP-dependent protein kinase |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
