| Identification |
| Name: | Pentanoylchloride, 5-chloro- |
| Synonyms: | Valerylchloride, 5-chloro- (6CI,7CI,8CI);5-Chloropentanoyl chloride;5-Chlorovalericacid chloride;5-Chlorovaleroyl chloride;NSC 84182; |
| CAS: | 1575-61-7 |
| EINECS: | 216-403-1 |
| Molecular Formula: | C5H8Cl2O |
| Molecular Weight: | 155.02 |
| InChI: | InChI=1/C5H8Cl2O/c6-4-2-1-3-5(7)8/h1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.2 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.463-1.465 |
| Water Solubility: | reacts |
| Solubility: | Reacts SOLVENT |
| Appearance: | clear to yellowish liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Safety Data |
| Hazard Symbols |
T:Toxic
C:Corrosive
|
| |
 |
