| Identification | ||
| Name: | 5-Chloro-2-methylaniline | |
| Synonyms: | 5-chloro-o-toluidinium chloride; 2-Amino-4-chlorotoluene hydrochloride; 1-amino-3-chloro-6-methylbenzene; 2-Amino-4-Chlorotoluene; red kb base; spectrolene red kb; stable red kb base; 2-Methyl-5-Chloroaniline; 3-chloro-6-methylaniline; 4-chloro-2-aminotoluene; 5-chloro-2-methyl-benzamine; 5-chloro-o-toluidine; 5-Chloro-2-Methylbenzenamine; acco fast red kb base; ansibase red kb; azoene fast red kb base; azoic diazo component 32; C.I. 37090; C.I. Azoic Diazo Component No. 32; fast red kb salt; fast red kb amine; fast red kb base; fast red kbs salt; fast red kb salt supra; genazo red kb soln; hiltonil fast red kb base; lake red bk base; metrogen red former kb soln; naphthosol fast red kb base; pharmazoid red kb; | |
| CAS: | 95-79-4 | |
| EINECS: | 202-452-6 | |
| Molecular Formula: | C7H8ClN | |
| Molecular Weight: | 141.6 | |
| InChI: | InChI=1/C7H8ClN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2239/3429 | |
| Density: | 1.18 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.583-1.585 | |
| Water Solubility: | < 1 g/L (22 ºC) | |
| Solubility: | < 1 g/L (22 oC) | |
| Appearance: | Grayish-white solid. | |
| Specification: | clear yellow to light brown liquid after melting Safety Statements:26-45-36/37/39-53 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 53:Avoid exposure - obtain special instruction before use | |
| Packinggroup: | III | |
| HS Code: | 29214300 | |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Color: | GRAYISH-WHITE SOLID | |
| Usage: | Synthesis of organic dyestuffs. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
