| Identification | |
| Name: | Pyridinium,3-carboxy-1-(phenylmethyl)-, inner salt |
| Synonyms: | 1-Benzyl-3-carboxypyridiniumhydroxide inner salt (6CI);Pyridinium, 3-carboxy-1-(phenylmethyl)-, hydroxide, inner salt;1-Benzylpyridinium-3-carboxylate;N-Benzyl nicotinate betaine;N-Benzylpyridinium-3-carboxylate; |
| CAS: | 15990-43-9 |
| EINECS: | 240-129-1 |
| Molecular Formula: | C13H11NO2 |
| Molecular Weight: | 213.23 |
| InChI: | InChI=1/C13H11NO2/c15-13(16)12-7-4-8-14(10-12)9-11-5-2-1-3-6-11/h1-8,10H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.09 |
| Refractive index: | 1.625 |
| Solubility: | Soluble in water |
| Appearance: | light yellow paste |
| Specification: |
N-Benzylniacin , its cas register number is 15990-43-9. It also can be called 1-Benzyl pyridinium-3-carboxylate ; N-Benzyl nicotinate betaine ; N-Benzylpyridinium-3-carboxylate ; 1-Benzyl-3-carboxypyridinium hydroxide inner salt ; Benzyl pyridinium 3-carboxylate and BPC-48 . |
| Safety Data | |
 |
|
