Identification |
Name: | Pyridinium,3-carboxy-1-methyl-, inner salt |
Synonyms: | Pyridinium,3-carboxy-1-methyl-, hydroxide, inner salt (8CI);Betaine nicotinate;Caffearine;Coffearin;Coffearine;Gynesine;N-Methylnicotinate;N-Methylnicotinic acid;Trigenolline;Trigonelline;1-methyl-1,2-dihydropyridine-3-carboxylic acid;N-methylnicotinic acid; |
CAS: | 535-83-1 |
EINECS: | 208-620-5 |
Molecular Formula: | C7H7NO2 |
Molecular Weight: | 137.1360 |
InChI: | InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 260°C (dec.) |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Refractive index: | 1.554 |
Solubility: | Soluble in alcohol; nearly insoluble in ether, benzene, and chloroform In water, 1.0X10+6 mg/L at 25 deg C (est) /miscible/ |
Specification: |
Trigonelline is an alkaloid with chemical formula C7H7NO2. It is an inner salt formed by the addition of a methyl group to the nitrogen atom of niacin. Trigonelline is a product of the metabolism of niacin (vitamin B3) which is excreted in the urine
|
Flash Point: | °C |
Color: | Colorless prisms Prisms from aqueous, alcohol, + water |
Safety Data |
|
|