| Identification | |
| Name: | 2-Amino-3-picoline |
| Synonyms: | 2-Amino-3-methylpyridine,97%; 3-methyl-2-pyridylamine; 2-Amino-3-methylpyridine |
| CAS: | 1603-40-3 |
| EINECS: | 216-501-4 |
| Molecular Formula: | C6H8N2 |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C6H8N2/c1-5-3-2-4-8-6(5)7/h2-4H,1H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.07 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5813-1.5833 |
| Water Solubility: | SOLUBLE |
| Solubility: | soluble in water |
| Appearance: | clear yellow liquid after melting |
| Specification: |
2-Amino-3-methylpyridine, with CAS number of 1603-40-3, can be called 2-Amino-3-picoline ; 2-Amino-beta-picoline ; 3-Methyl-2-aminopyridine ; 3-Methyl-2-pyridinamine ; Pyridine, 2-amino-3-methyl- . It is a clear yellow liquid after melting. 2-Amino-3-methylpyridine(CAS NO.1603-40-3) can be used as pharmaceutical raw materials and intermediates. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29333999 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
