| Identification |
| Name: | 2-Amino-6-picoline |
| Synonyms: | 2-Amino-6-methylpyridine; 6-Amino-2-picoline; 6-methyl-2-pyridylamine |
| CAS: | 1824-81-3 |
| EINECS: | 217-360-1 |
| Molecular Formula: | C6H8N2 |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C6H8N2/c1-5-3-2-4-6(7)8-5/h2-4H,1H3,(H2,7,8) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1759 |
| Density: | 1.068 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.574 |
| Solubility: | Soluble |
| Appearance: | white to pale yellow solid |
| Packinggroup: | II |
| HS Code: | 29333999 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
